| dc.creator |
KARTAL, Zerrin |
|
| dc.creator |
BAHCELI, S |
|
| dc.creator |
Turkoz, Deniz |
|
| dc.date |
2004-06-30T21:00:00Z |
|
| dc.date.accessioned |
2020-10-06T10:50:23Z |
|
| dc.date.available |
2020-10-06T10:50:23Z |
|
| dc.identifier |
9e1b844f-9eca-48c6-b505-7d3abf6d8bcd |
|
| dc.identifier |
10.1515/zna-2004-7-819 |
|
| dc.identifier |
https://avesis.sdu.edu.tr/publication/details/9e1b844f-9eca-48c6-b505-7d3abf6d8bcd/oai |
|
| dc.identifier.uri |
http://acikerisim.sdu.edu.tr/xmlui/handle/123456789/67646 |
|
| dc.description |
By vibrational spectroscopy of the new Hofmann-propanethiol-type clathrate Co(1-propanethiol)(2)Ni(CN)(4) .Benzene it is shown that its structure is similar structure to those of other Hofmann-type clathrates. |
|
| dc.language |
eng |
|
| dc.rights |
info:eu-repo/semantics/closedAccess |
|
| dc.title |
FT-IR spectroscopic study of Co(1-propanethiol)(2) Ni(CN)(4)center dot benzene clathrate |
|
| dc.type |
info:eu-repo/semantics/article |
|